CAS 175278-44-1 appears in our catalog under these names: 4-(Benzylthio)-3-nitrobenzaldehyde, 95%, 4-(Benzylthio)-3-nitrobenzaldehyde, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 500mg, 1g.
4-benzylsulfanyl-3-nitrobenzaldehyde (CAS 175278-44-1) is a chemical compound with the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. IUPAC name: 4-benzylsulfanyl-3-nitrobenzaldehyde. InChIKey: UIXPQYSMFXQEMB-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 4-benzylsulfanyl-3-nitrobenzaldehyde |
| InChIKey | UIXPQYSMFXQEMB-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CSC2=C(C=C(C=C2)C=O)[N+](=O)[O-] |
Computed by PubChem (NCBI)