CAS 26638-46-0 is the registry number for Tianeptine Impurity 12. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
6-methyl-5,5-dioxobenzo[c][1,2]benzothiazepin-11-one (CAS 26638-46-0) is a chemical compound with the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. IUPAC name: 6-methyl-5,5-dioxobenzo[c][1,2]benzothiazepin-11-one. InChIKey: SIECFEVCKFXEEC-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 6-methyl-5,5-dioxobenzo[c][1,2]benzothiazepin-11-one |
| InChIKey | SIECFEVCKFXEEC-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C(=O)C3=CC=CC=C3S1(=O)=O |
Computed by PubChem (NCBI)