Products 1220-99-1
CAS 1220-99-1 is the registry number for Promethazine Impurity 1. Offered by: Chemat Brand. Available pack sizes: on request.
1-(5,5-dioxophenothiazin-10-yl)ethanone (CAS 1220-99-1) is a chemical compound with the molecular formula C14H11NO3S and a molecular weight of 273.31 g/mol. IUPAC name: 1-(5,5-dioxophenothiazin-10-yl)ethanone. InChIKey: UNVGDZPNNRQUNC-UHFFFAOYSA-N.
| Molecular formula | C14H11NO3S |
|---|---|
| Molecular weight | 273.31 g/mol |
| IUPAC name | 1-(5,5-dioxophenothiazin-10-yl)ethanone |
| InChIKey | UNVGDZPNNRQUNC-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C2=CC=CC=C2S(=O)(=O)C3=CC=CC=C31 |
Computed by PubChem (NCBI)
Synonyms:
1-(5,5-dioxophenothiazin-10-yl)ethanone, 10H-Phenothiazine, 10-acetyl-, 5,5-dioxide, N-Acetylphenothiazine S,S-dioxide, Promethazine Impurity 1, Phenothiazine, 10-acetyl-, 5,5-dioxide, UNVGDZPNNRQUNC-UHFFFAOYSA-N, 10-Acetyl-10H-phenothiazine 5,5-dioxide, 10-Acetyl-10H-phenothiazine 5,5-dioxide #, 1-(5,5-Dioxido-10H-phenothiazin-10-yl)ethanone, 10-Acetyl-5lambda~6~-phenothiazine-5,5(10H)-dione