CAS 113765-39-2 is the registry number for 3,5-Bis(isopropyl)phenyl Diphenyl Phosphate. Offered by: TRC. Available pack sizes: 2,5g.
[3,5-di(propan-2-yl)phenyl] diphenyl phosphate (CAS 113765-39-2) is a chemical compound with the molecular formula C24H27O4P and a molecular weight of 410.4 g/mol. IUPAC name: [3,5-di(propan-2-yl)phenyl] diphenyl phosphate. InChIKey: PYIXRBAUGAEEEW-UHFFFAOYSA-N.
| Molecular formula | C24H27O4P |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | [3,5-di(propan-2-yl)phenyl] diphenyl phosphate |
| InChIKey | PYIXRBAUGAEEEW-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=CC(=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3)C(C)C |
Computed by PubChem (NCBI)