Products 96107-55-0
CAS 96107-55-0 is the registry number for 2,4-Bis(1-methylethyl)phenyl Diphenyl Ester Phosphoric Acid, >95% (HPLC). Offered by: TRC. Available pack sizes: 250mg, 500mg, 50mg.
[2,4-di(propan-2-yl)phenyl] diphenyl phosphate (CAS 96107-55-0) is a chemical compound with the molecular formula C24H27O4P and a molecular weight of 410.4 g/mol. IUPAC name: [2,4-di(propan-2-yl)phenyl] diphenyl phosphate. InChIKey: DZONBDFKZXLORJ-UHFFFAOYSA-N.
| Molecular formula | C24H27O4P |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | [2,4-di(propan-2-yl)phenyl] diphenyl phosphate |
| InChIKey | DZONBDFKZXLORJ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC(=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
2,4-Di(propan-2-yl)phenyl diphenyl phosphate, [2,4-di(propan-2-yl)phenyl] diphenyl phosphate, 2,4-Bis(1-methylethyl)phenyl Diphenyl Ester Phosphoric Acid, Phosphoric acid, 2,4-bis(1-methylethyl)phenyl diphenyl ester, 2,4-diisopropylphenyl diphenyl phosphate, (2,4-diisopropylphenyl) diphenyl phosphate, 2,4-Bis(1-methylethyl)phenyl diphenyl phosphate Solution in Acetone, 100ug/mL