Products 65695-97-8
CAS 65695-97-8 is the registry number for tris(2,3-Dimethylphenyl) Phosphate. Offered by: TRC. Available pack sizes: 1g.
Tris(2,3-dimethylphenyl) phosphate (CAS 65695-97-8) is a chemical compound with the molecular formula C24H27O4P and a molecular weight of 410.4 g/mol. IUPAC name: tris(2,3-dimethylphenyl) phosphate. InChIKey: CAPOZRICGSDRLP-UHFFFAOYSA-N.
| Molecular formula | C24H27O4P |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | tris(2,3-dimethylphenyl) phosphate |
| InChIKey | CAPOZRICGSDRLP-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)OP(=O)(OC2=CC=CC(=C2C)C)OC3=CC=CC(=C3C)C)C |
Computed by PubChem (NCBI)