Products 68155-51-1
CAS 68155-51-1 is the registry number for 3,4-Bis(isopropyl)phenyl Diphenyl Phosphate. Offered by: TRC. Available pack sizes: 250mg.
[3,4-di(propan-2-yl)phenyl] diphenyl phosphate (CAS 68155-51-1) is a chemical compound with the molecular formula C24H27O4P and a molecular weight of 410.4 g/mol. IUPAC name: [3,4-di(propan-2-yl)phenyl] diphenyl phosphate. InChIKey: CGYONFZXYNCFCN-UHFFFAOYSA-N.
| Molecular formula | C24H27O4P |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | [3,4-di(propan-2-yl)phenyl] diphenyl phosphate |
| InChIKey | CGYONFZXYNCFCN-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=C(C=C1)OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3)C(C)C |
Computed by PubChem (NCBI)
Synonyms:
3,4-Diisopropylphenyl diphenyl phosphate, Phosphoric acid, 3,4-bis(1-methylethyl)phenyl diphenyl ester, 3,4-Bis(isopropyl)phenyl Diphenyl Phosphate, [3,4-di(propan-2-yl)phenyl] diphenyl phosphate, CGYONFZXYNCFCN-UHFFFAOYSA-N, Diisopropylphenyl diphenyl phosphate, 3,4-Di(propan-2-yl)phenyl diphenyl phosphate, 3,4-Bis(1-methylethyl)phenyl diphenyl phosphate