Products 19074-59-0
CAS 19074-59-0 appears in our catalog under these names: Tris(2,5-dimethylphenyl) phosphate, 98%, 98%, Tris(2,5-dimethylphenyl) phosphate, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Tris(2,5-dimethylphenyl) phosphate (CAS 19074-59-0) is a chemical compound with the molecular formula C24H27O4P and a molecular weight of 410.4 g/mol. IUPAC name: tris(2,5-dimethylphenyl) phosphate. InChIKey: MDHAARLWBHZGIP-UHFFFAOYSA-N.
| Molecular formula | C24H27O4P |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | tris(2,5-dimethylphenyl) phosphate |
| InChIKey | MDHAARLWBHZGIP-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)OP(=O)(OC2=C(C=CC(=C2)C)C)OC3=C(C=CC(=C3)C)C |
Computed by PubChem (NCBI)
Synonyms:
Tris(2,5-xylyl) phosphate, Tri(2,5-dimethylphenyl) phosphate, Tri(2,5-xylenyl)phosphate, Phosphoric acid, tris(2,5-dimethylphenyl) ester, Tri(2,5xylenyl)phosphate, Tris(2,5xylyl) phosphate, Tri(2,5dimethylphenyl) phosphate, Phosphoric acid, tris(2,5-dimethylphenyl)ester, Phosphoric acid, tris(2,5dimethylphenyl) ester, tris(2,5-dimethylphenyl) phosphate