CAS 3862-11-1 is the registry number for 3,4-Xylenol Phosphate. Offered by: TRC. Available pack sizes: 5g.
Tris(3,4-dimethylphenyl) phosphate (CAS 3862-11-1) is a chemical compound with the molecular formula C24H27O4P and a molecular weight of 410.4 g/mol. IUPAC name: tris(3,4-dimethylphenyl) phosphate. InChIKey: BCTKCHOESSAGCN-UHFFFAOYSA-N.
| Molecular formula | C24H27O4P |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | tris(3,4-dimethylphenyl) phosphate |
| InChIKey | BCTKCHOESSAGCN-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)OP(=O)(OC2=CC(=C(C=C2)C)C)OC3=CC(=C(C=C3)C)C)C |
Computed by PubChem (NCBI)