Products 69500-29-4
CAS 69500-29-4 is the registry number for Bis(2-isopropylphenyl) Phenyl Phosphate. Offered by: TRC, MedChemExpress. Available pack sizes: 500mg, 50mg, 25 mg, 50 mg, 10 mg, 5 mg.
Phenyl bis(2-propan-2-ylphenyl) phosphate (CAS 69500-29-4) is a chemical compound with the molecular formula C24H27O4P and a molecular weight of 410.4 g/mol. IUPAC name: phenyl bis(2-propan-2-ylphenyl) phosphate. InChIKey: RMNODSGCFHVNDC-UHFFFAOYSA-N.
| Molecular formula | C24H27O4P |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | phenyl bis(2-propan-2-ylphenyl) phosphate |
| InChIKey | RMNODSGCFHVNDC-UHFFFAOYSA-N |
| SMILES | CC(C)C1=CC=CC=C1OP(=O)(OC2=CC=CC=C2)OC3=CC=CC=C3C(C)C |
Computed by PubChem (NCBI)
Synonyms:
Di(isopropylphenyl) phenyl phosphate, Phosphoric acid, bis((1-methylethyl)phenyl) phenyl ester, BIS(ISOPROPYLPHENYL) PHENYL PHOSPHATE, Phosphoric acid, bis[(1-methylethyl)phenyl] phenyl ester, phenyl di(isopropylphenyl) phosphate, Phosphoric acid, bis((1-methylethyl)phenyl) phenyl ester (9CI), BIS(ISOPROPYLPHENYL) PHENYL PHOSPHATE [HSDB], Phosphoric acid, bis((1methylethyl)phenyl) phenyl ester, BIS(ISOPROPYLPHENYL) PHENYL PHOSPHATE (MIXED ISOMERS), Bis(2-isopropylphenyl) Phenyl Phosphate