Products 25653-16-1
CAS 25653-16-1 appears in our catalog under these names: 3,5-Xylenol Phosphate, >95% (HPLC), Tri-3,5-xylyl phosphate. Offered by: TRC, Dr. Ehrenstorfer. Available pack sizes: 10g, 1g, 25mg.
Tris(3,5-dimethylphenyl) phosphate (CAS 25653-16-1) is a chemical compound with the molecular formula C24H27O4P and a molecular weight of 410.4 g/mol. IUPAC name: tris(3,5-dimethylphenyl) phosphate. InChIKey: LLPMAOBOEQFPRE-UHFFFAOYSA-N.
| Molecular formula | C24H27O4P |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | tris(3,5-dimethylphenyl) phosphate |
| InChIKey | LLPMAOBOEQFPRE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)OP(=O)(OC2=CC(=CC(=C2)C)C)OC3=CC(=CC(=C3)C)C)C |
Computed by PubChem (NCBI)
Synonyms:
tris(3,5-dimethylphenyl) phosphate, Tris(3,5-xylyl) phosphate, Tri(3,5-xylenyl)phosphate, Phosphoric acid, tris(3,5-dimethylphenyl) ester, Tri(3,5xylenyl)phosphate, Tris(3,5xylyl) phosphate, Phosphoric acid, tris(3,5-dimethylphenyl)ester, Phosphoric acid, tris(3,5dimethylphenyl) ester, 3,5-Xylenol Phosphate, Phenol, 3,5-dimethyl-,1,1',1''-phosphate