CAS 1144-74-7 appears in our catalog under these names: 4–Nitrobenzophenone, 4-Nitrobenzophenone, 99% , 4-Nitrobenzophenone, >99.0%(GC), 4-Nitrobenzophenone, 4-Nitrobenzophenone 98%. Offered by: GLPBio, Thermo Scientific (Alfa Aesar), TCI, Biosynth, Ambeed. Available pack sizes: 100g, 5g, 25g, 10g, 500g.
(4-nitrophenyl)-phenylmethanone (CAS 1144-74-7) is a chemical compound with the molecular formula C13H9NO3 and a molecular weight of 227.21 g/mol. IUPAC name: (4-nitrophenyl)-phenylmethanone. InChIKey: ZYMCBJWUWHHVRX-UHFFFAOYSA-N.
| Molecular formula | C13H9NO3 |
|---|---|
| Molecular weight | 227.21 g/mol |
| IUPAC name | (4-nitrophenyl)-phenylmethanone |
| InChIKey | ZYMCBJWUWHHVRX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)