Products 93496-61-8
CAS 93496-61-8 is the registry number for (4-Nitrophenyl)(phenyl)methanone-d5. Offered by: MedChemExpress. Available pack sizes: 1 mg.
(4-nitrophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone (CAS 93496-61-8) is a chemical compound with the molecular formula C13H9NO3 and a molecular weight of 232.25 g/mol. IUPAC name: (4-nitrophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone. InChIKey: ZYMCBJWUWHHVRX-RALIUCGRSA-N.
| Molecular formula | C13H9NO3 |
|---|---|
| Molecular weight | 232.25 g/mol |
| IUPAC name | (4-nitrophenyl)-(2,3,4,5,6-pentadeuteriophenyl)methanone |
| InChIKey | ZYMCBJWUWHHVRX-RALIUCGRSA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])C(=O)C2=CC=C(C=C2)[N+](=O)[O-])[2H])[2H] |
Computed by PubChem (NCBI)