Products 1146854-22-9
CAS 1146854-22-9 is the registry number for 1-(2,6-Dichloro-phenyl)-2,2,2-trifluoro-ethanol, 98%. Offered by: Fluorochem. Available pack sizes: 1g, 5g.
1-(2,6-dichlorophenyl)-2,2,2-trifluoroethanol (CAS 1146854-22-9) is a chemical compound with the molecular formula C8H5Cl2F3O and a molecular weight of 245.02 g/mol. IUPAC name: 1-(2,6-dichlorophenyl)-2,2,2-trifluoroethanol. InChIKey: FOPZLSDSXPODKZ-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2F3O |
|---|---|
| Molecular weight | 245.02 g/mol |
| IUPAC name | 1-(2,6-dichlorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | FOPZLSDSXPODKZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(C(F)(F)F)O)Cl |
Computed by PubChem (NCBI)