Products 1152566-31-8
CAS 1152566-31-8 is the registry number for Methyl 4-(4-cyanophenyl)-2,4-dioxobutanoate. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
Methyl 4-(4-cyanophenyl)-2,4-dioxobutanoate (CAS 1152566-31-8) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: methyl 4-(4-cyanophenyl)-2,4-dioxobutanoate. InChIKey: JZVZUZGNSNDDQQ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | methyl 4-(4-cyanophenyl)-2,4-dioxobutanoate |
| InChIKey | JZVZUZGNSNDDQQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC=C(C=C1)C#N |
Computed by PubChem (NCBI)