CAS 1157546-45-6 is the registry number for 3-(2,3-Dihydro-1-benzofuran-5-yl)-1,2-oxazole-5-carboxylic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-(2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazole-5-carboxylic acid (CAS 1157546-45-6) is a chemical compound with the molecular formula C12H9NO4 and a molecular weight of 231.20 g/mol. IUPAC name: 3-(2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazole-5-carboxylic acid. InChIKey: YLZWIRUONYPDCZ-UHFFFAOYSA-N.
| Molecular formula | C12H9NO4 |
|---|---|
| Molecular weight | 231.20 g/mol |
| IUPAC name | 3-(2,3-dihydro-1-benzofuran-5-yl)-1,2-oxazole-5-carboxylic acid |
| InChIKey | YLZWIRUONYPDCZ-UHFFFAOYSA-N |
| SMILES | C1COC2=C1C=C(C=C2)C3=NOC(=C3)C(=O)O |
Computed by PubChem (NCBI)