CAS 115840-37-4 appears in our catalog under these names: 2-Chloro-1-(2,6-dimethylmorpholino)propan-1-one, 98%, 2-Chloro-1-(2,6-dimethylmorpholin-4-yl)propan-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 10g, 1g, 100mg.
2-chloro-1-(2,6-dimethylmorpholin-4-yl)propan-1-one (CAS 115840-37-4) is a chemical compound with the molecular formula C9H16ClNO2 and a molecular weight of 205.68 g/mol. IUPAC name: 2-chloro-1-(2,6-dimethylmorpholin-4-yl)propan-1-one. InChIKey: CQXVMOSWWGTUHF-UHFFFAOYSA-N.
| Molecular formula | C9H16ClNO2 |
|---|---|
| Molecular weight | 205.68 g/mol |
| IUPAC name | 2-chloro-1-(2,6-dimethylmorpholin-4-yl)propan-1-one |
| InChIKey | CQXVMOSWWGTUHF-UHFFFAOYSA-N |
| SMILES | CC1CN(CC(O1)C)C(=O)C(C)Cl |
Computed by PubChem (NCBI)