CAS 1158787-43-9 is the registry number for 3-​Benzofuransulfonamid​e. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
1-benzofuran-3-sulfonamide (CAS 1158787-43-9) is a chemical compound with the molecular formula C8H7NO3S and a molecular weight of 197.21 g/mol. IUPAC name: 1-benzofuran-3-sulfonamide. InChIKey: NNJIGDHOUPBYOR-UHFFFAOYSA-N.
| Molecular formula | C8H7NO3S |
|---|---|
| Molecular weight | 197.21 g/mol |
| IUPAC name | 1-benzofuran-3-sulfonamide |
| InChIKey | NNJIGDHOUPBYOR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CO2)S(=O)(=O)N |
Computed by PubChem (NCBI)