CAS 1159813-21-4 appears in our catalog under these names: 4–Amino–2,6–dichloronicotinaldehyde, 4-Amino-2,6-dichloronicotinaldehyde 95%. Offered by: GLPBio, Ambeed. Available pack sizes: 100mg, 250mg.
4-amino-2,6-dichloropyridine-3-carbaldehyde (CAS 1159813-21-4) is a chemical compound with the molecular formula C6H4Cl2N2O and a molecular weight of 191.01 g/mol. IUPAC name: 4-amino-2,6-dichloropyridine-3-carbaldehyde. InChIKey: ACBYGOXGXLOWMQ-UHFFFAOYSA-N.
| Molecular formula | C6H4Cl2N2O |
|---|---|
| Molecular weight | 191.01 g/mol |
| IUPAC name | 4-amino-2,6-dichloropyridine-3-carbaldehyde |
| InChIKey | ACBYGOXGXLOWMQ-UHFFFAOYSA-N |
| SMILES | C1=C(C(=C(N=C1Cl)Cl)C=O)N |
Computed by PubChem (NCBI)