CAS 1160424-29-2 is the registry number for (2S)-1-(2,4,6-Trimethylbenzenesulfonyl)pyrrolidine-2-carboxylic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(2S)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylic acid (CAS 1160424-29-2) is a chemical compound with the molecular formula C14H19NO4S and a molecular weight of 297.37 g/mol. IUPAC name: (2S)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylic acid. InChIKey: WOOZXNKLFHMTLX-LBPRGKRZSA-N.
| Molecular formula | C14H19NO4S |
|---|---|
| Molecular weight | 297.37 g/mol |
| IUPAC name | (2S)-1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylic acid |
| InChIKey | WOOZXNKLFHMTLX-LBPRGKRZSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)N2CCC[C@H]2C(=O)O)C |
Computed by PubChem (NCBI)