CAS 126522-74-5 is the registry number for 1-(Mesitylsulfonyl)pyrrolidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.
1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylic acid (CAS 126522-74-5) is a chemical compound with the molecular formula C14H19NO4S and a molecular weight of 297.37 g/mol. IUPAC name: 1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylic acid. InChIKey: WOOZXNKLFHMTLX-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4S |
|---|---|
| Molecular weight | 297.37 g/mol |
| IUPAC name | 1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylic acid |
| InChIKey | WOOZXNKLFHMTLX-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)N2CCCC2C(=O)O)C |
Computed by PubChem (NCBI)