Products 126522-74-5

CAS 126522-74-5 is the registry number for 1-(Mesitylsulfonyl)pyrrolidine-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 100mg, 250mg, 10g.

Structural formula: {0} (CAS {1})

1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylic acid (CAS 126522-74-5) is a chemical compound with the molecular formula C14H19NO4S and a molecular weight of 297.37 g/mol. IUPAC name: 1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylic acid. InChIKey: WOOZXNKLFHMTLX-UHFFFAOYSA-N.

Identity
Molecular formulaC14H19NO4S
Molecular weight297.37 g/mol
IUPAC name1-(2,4,6-trimethylphenyl)sulfonylpyrrolidine-2-carboxylic acid
InChIKeyWOOZXNKLFHMTLX-UHFFFAOYSA-N
SMILESCC1=CC(=C(C(=C1)C)S(=O)(=O)N2CCCC2C(=O)O)C

Computed by PubChem (NCBI)