CAS 749219-29-2 appears in our catalog under these names: 4-(3,5-Dimethyl-piperidine-1-sulfonyl)-benzoic acid, 95%, 4-((3,5-Dimethylpiperidin-1-yl)sulfonyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g, 100mg, 10g.
4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoic acid (CAS 749219-29-2) is a chemical compound with the molecular formula C14H19NO4S and a molecular weight of 297.37 g/mol. IUPAC name: 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoic acid. InChIKey: RDLUCWBSZMWQDA-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4S |
|---|---|
| Molecular weight | 297.37 g/mol |
| IUPAC name | 4-(3,5-dimethylpiperidin-1-yl)sulfonylbenzoic acid |
| InChIKey | RDLUCWBSZMWQDA-UHFFFAOYSA-N |
| SMILES | CC1CC(CN(C1)S(=O)(=O)C2=CC=C(C=C2)C(=O)O)C |
Computed by PubChem (NCBI)