CAS 1161833-78-8 appears in our catalog under these names: 6-Methoxy-1,2,3,4-tetrahydro-isoquinoline-1-carboxylic acid, 95%, 6-Methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid, 98%, 6-Methoxy-1,2,3,4-tetrahydro-isoquinoline-1-carboxylic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g, 500mg.
6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (CAS 1161833-78-8) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: 6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid. InChIKey: QIRHLLVXHCWXEL-UHFFFAOYSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | 6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid |
| InChIKey | QIRHLLVXHCWXEL-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C=C1)C(NCC2)C(=O)O |
Computed by PubChem (NCBI)