CAS 1389888-62-3 is the registry number for (S)-6-Methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1S)-6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (CAS 1389888-62-3) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: (1S)-6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid. InChIKey: QIRHLLVXHCWXEL-JTQLQIEISA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | (1S)-6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid |
| InChIKey | QIRHLLVXHCWXEL-JTQLQIEISA-N |
| SMILES | COC1=CC2=C(C=C1)[C@H](NCC2)C(=O)O |
Computed by PubChem (NCBI)