CAS 1390715-99-7 appears in our catalog under these names: (1R)-6-Methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid, 95%, (R)–6–Methoxy–1,2,3,4–tetrahydroisoquinoline–1–carboxylic acid, (R)-6-Methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid, 95%, 95%, (R)-6-Methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid, 95%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 25mg.
(1R)-6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid (CAS 1390715-99-7) is a chemical compound with the molecular formula C11H13NO3 and a molecular weight of 207.23 g/mol. IUPAC name: (1R)-6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid. InChIKey: QIRHLLVXHCWXEL-SNVBAGLBSA-N.
| Molecular formula | C11H13NO3 |
|---|---|
| Molecular weight | 207.23 g/mol |
| IUPAC name | (1R)-6-methoxy-1,2,3,4-tetrahydroisoquinoline-1-carboxylic acid |
| InChIKey | QIRHLLVXHCWXEL-SNVBAGLBSA-N |
| SMILES | COC1=CC2=C(C=C1)[C@@H](NCC2)C(=O)O |
Computed by PubChem (NCBI)