CAS 116314-52-4 appears in our catalog under these names: Entacapone Impurity 2(Entacapone EP Impurity B), OR 545, 2-Cyano-3-(3,4-dihydroxy-5-nitrophenyl)-2-propenoic acid ethyl ester. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 250mg.
Ethyl (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoate (CAS 116314-52-4) is a chemical compound with the molecular formula C12H10N2O6 and a molecular weight of 278.22 g/mol. IUPAC name: ethyl (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoate. InChIKey: KZGBADQGBKGUGS-FPYGCLRLSA-N.
| Molecular formula | C12H10N2O6 |
|---|---|
| Molecular weight | 278.22 g/mol |
| IUPAC name | ethyl (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoate |
| InChIKey | KZGBADQGBKGUGS-FPYGCLRLSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC(=C(C(=C1)O)O)[N+](=O)[O-])/C#N |
Computed by PubChem (NCBI)