CAS 1178554-79-4 is the registry number for 4-Aminobenzoyl-n-hydroxysuccinimidyl carbamate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]benzoic acid (CAS 1178554-79-4) is a chemical compound with the molecular formula C12H10N2O6 and a molecular weight of 278.22 g/mol. IUPAC name: 4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]benzoic acid. InChIKey: GJNMPIDEXWTEDJ-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O6 |
|---|---|
| Molecular weight | 278.22 g/mol |
| IUPAC name | 4-[(2,5-dioxopyrrolidin-1-yl)oxycarbonylamino]benzoic acid |
| InChIKey | GJNMPIDEXWTEDJ-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)NC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)