Products 651747-69-2
CAS 651747-69-2 is the registry number for Dimethyl 2-(4-cyano-2-nitrophenyl)malonate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 500g, 5g.
Dimethyl 2-(4-cyano-2-nitrophenyl)propanedioate (CAS 651747-69-2) is a chemical compound with the molecular formula C12H10N2O6 and a molecular weight of 278.22 g/mol. IUPAC name: dimethyl 2-(4-cyano-2-nitrophenyl)propanedioate. InChIKey: VTDCKPNYQDVOLO-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O6 |
|---|---|
| Molecular weight | 278.22 g/mol |
| IUPAC name | dimethyl 2-(4-cyano-2-nitrophenyl)propanedioate |
| InChIKey | VTDCKPNYQDVOLO-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C1=C(C=C(C=C1)C#N)[N+](=O)[O-])C(=O)OC |
Computed by PubChem (NCBI)