CAS 2365228-94-8 is the registry number for 2-Methyl-5-nitro-benzoic acid 2,5-dioxo-pyrrolidin-1-yl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(2,5-dioxopyrrolidin-1-yl) 2-methyl-5-nitrobenzoate (CAS 2365228-94-8) is a chemical compound with the molecular formula C12H10N2O6 and a molecular weight of 278.22 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 2-methyl-5-nitrobenzoate. InChIKey: DCVUISKJTNQWPG-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O6 |
|---|---|
| Molecular weight | 278.22 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 2-methyl-5-nitrobenzoate |
| InChIKey | DCVUISKJTNQWPG-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)[N+](=O)[O-])C(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)