CAS 1215039-66-9 appears in our catalog under these names: Entacapone EP Impurity B, Ethyl (2E)-2-Cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoate. Offered by: Chemat Brand, TRC, Mikromol. Available pack sizes: on request, 500mg, 25mg.
Ethyl (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoate (CAS 1215039-66-9) is a chemical compound with the molecular formula C12H10N2O6 and a molecular weight of 278.22 g/mol. IUPAC name: ethyl (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoate. InChIKey: KZGBADQGBKGUGS-FPYGCLRLSA-N.
| Molecular formula | C12H10N2O6 |
|---|---|
| Molecular weight | 278.22 g/mol |
| IUPAC name | ethyl (E)-2-cyano-3-(3,4-dihydroxy-5-nitrophenyl)prop-2-enoate |
| InChIKey | KZGBADQGBKGUGS-FPYGCLRLSA-N |
| SMILES | CCOC(=O)/C(=C/C1=CC(=C(C(=C1)O)O)[N+](=O)[O-])/C#N |
Computed by PubChem (NCBI)