CAS 892293-07-1 is the registry number for 3-(6,8-Dioxo-5,8-dihydro[1,3]dioxolo[4,5-g]quinazolin-7(6h)-yl)propanoic acid, 90%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
3-(6,8-dioxo-5H-[1,3]dioxolo[4,5-g]quinazolin-7-yl)propanoic acid (CAS 892293-07-1) is a chemical compound with the molecular formula C12H10N2O6 and a molecular weight of 278.22 g/mol. IUPAC name: 3-(6,8-dioxo-5H-[1,3]dioxolo[4,5-g]quinazolin-7-yl)propanoic acid. InChIKey: NOTHTUUNKBDEPM-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O6 |
|---|---|
| Molecular weight | 278.22 g/mol |
| IUPAC name | 3-(6,8-dioxo-5H-[1,3]dioxolo[4,5-g]quinazolin-7-yl)propanoic acid |
| InChIKey | NOTHTUUNKBDEPM-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)C(=O)N(C(=O)N3)CCC(=O)O |
Computed by PubChem (NCBI)