CAS 4722-91-2 appears in our catalog under these names: 5,6-Dimethoxy-2'h,4'h-spiro[indole-3,5'-[1,3]oxazolidine]-2,2',4'(1h)-trione, 95%, 5,6-Dimethoxyspiro(indoline-3,5'-oxazolidine)-2,2',4'-trione, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
5',6'-dimethoxyspiro[1,3-oxazolidine-5,3'-1H-indole]-2,2',4-trione (CAS 4722-91-2) is a chemical compound with the molecular formula C12H10N2O6 and a molecular weight of 278.22 g/mol. IUPAC name: 5',6'-dimethoxyspiro[1,3-oxazolidine-5,3'-1H-indole]-2,2',4-trione. InChIKey: TYGJCPGRNJTBFD-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O6 |
|---|---|
| Molecular weight | 278.22 g/mol |
| IUPAC name | 5',6'-dimethoxyspiro[1,3-oxazolidine-5,3'-1H-indole]-2,2',4-trione |
| InChIKey | TYGJCPGRNJTBFD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C3(C(=O)N2)C(=O)NC(=O)O3)OC |
Computed by PubChem (NCBI)