Products 2089649-57-8
CAS 2089649-57-8 appears in our catalog under these names: 4-([(2,5-Dioxopyrrolidine-1-yl)carbonyloxy]aminobenzoic acid, 95%, 4-{((2,5-DIOXOPYRROLIDINE-1-YL)CARBONYLOXY)AMINOBENZOIC ACID, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
4-[(2,5-dioxopyrrolidine-1-carbonyl)oxyamino]benzoic acid (CAS 2089649-57-8) is a chemical compound with the molecular formula C12H10N2O6 and a molecular weight of 278.22 g/mol. IUPAC name: 4-[(2,5-dioxopyrrolidine-1-carbonyl)oxyamino]benzoic acid. InChIKey: SEHVTOUODQIHNR-UHFFFAOYSA-N.
| Molecular formula | C12H10N2O6 |
|---|---|
| Molecular weight | 278.22 g/mol |
| IUPAC name | 4-[(2,5-dioxopyrrolidine-1-carbonyl)oxyamino]benzoic acid |
| InChIKey | SEHVTOUODQIHNR-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)C(=O)ONC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)