CAS 116865-83-9 is the registry number for Econazole Impurity 3. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-1-(3,5-dichlorophenyl)ethanone (CAS 116865-83-9) is a chemical compound with the molecular formula C8H5Cl3O and a molecular weight of 223.5 g/mol. IUPAC name: 2-chloro-1-(3,5-dichlorophenyl)ethanone. InChIKey: AWVYVDZUZAHYEJ-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O |
|---|---|
| Molecular weight | 223.5 g/mol |
| IUPAC name | 2-chloro-1-(3,5-dichlorophenyl)ethanone |
| InChIKey | AWVYVDZUZAHYEJ-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1Cl)Cl)C(=O)CCl |
Computed by PubChem (NCBI)