CAS 5157-57-3 is the registry number for 2,2-dichloro-1-(4-chlorophenyl)ethanone, >95% (HPLC). Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
2,2-dichloro-1-(4-chlorophenyl)ethanone (CAS 5157-57-3) is a chemical compound with the molecular formula C8H5Cl3O and a molecular weight of 223.5 g/mol. IUPAC name: 2,2-dichloro-1-(4-chlorophenyl)ethanone. InChIKey: BZOFRNRRMMEHOB-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O |
|---|---|
| Molecular weight | 223.5 g/mol |
| IUPAC name | 2,2-dichloro-1-(4-chlorophenyl)ethanone |
| InChIKey | BZOFRNRRMMEHOB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C(Cl)Cl)Cl |
Computed by PubChem (NCBI)