CAS 53056-20-5 is the registry number for (2,4-Dichloro-phenyl)acetyl chloride, 96%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
2-(2,4-dichlorophenyl)acetyl chloride (CAS 53056-20-5) is a chemical compound with the molecular formula C8H5Cl3O and a molecular weight of 223.5 g/mol. IUPAC name: 2-(2,4-dichlorophenyl)acetyl chloride. InChIKey: RYXAJKPGHHNCSO-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O |
|---|---|
| Molecular weight | 223.5 g/mol |
| IUPAC name | 2-(2,4-dichlorophenyl)acetyl chloride |
| InChIKey | RYXAJKPGHHNCSO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)CC(=O)Cl |
Computed by PubChem (NCBI)