CAS 61875-53-4 appears in our catalog under these names: 2-(2,6-Dichlorophenyl)acetyl chloride, 95%, 2-(2,6-Dichlorophenyl)acetyl chloride, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 1g, 250mg, 5g.
2-(2,6-dichlorophenyl)acetyl chloride (CAS 61875-53-4) is a chemical compound with the molecular formula C8H5Cl3O and a molecular weight of 223.5 g/mol. IUPAC name: 2-(2,6-dichlorophenyl)acetyl chloride. InChIKey: VFRDBQGBQYINBH-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O |
|---|---|
| Molecular weight | 223.5 g/mol |
| IUPAC name | 2-(2,6-dichlorophenyl)acetyl chloride |
| InChIKey | VFRDBQGBQYINBH-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)CC(=O)Cl)Cl |
Computed by PubChem (NCBI)