CAS 6831-55-6 appears in our catalog under these names: (3,4-Dichloro-phenyl)-acetyl chloride, 98%, (3,4-Dichloro-phenyl)-acetyl chloride, 95%. Offered by: Chemat Brand, Fluorochem. Available pack sizes: on request, 1g.
2-(3,4-dichlorophenyl)acetyl chloride (CAS 6831-55-6) is a chemical compound with the molecular formula C8H5Cl3O and a molecular weight of 223.5 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)acetyl chloride. InChIKey: CJJURHKDGQSBLE-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O |
|---|---|
| Molecular weight | 223.5 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)acetyl chloride |
| InChIKey | CJJURHKDGQSBLE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1CC(=O)Cl)Cl)Cl |
Computed by PubChem (NCBI)