CAS 81547-71-9 appears in our catalog under these names: Econazole Impurity 2, 2-Chloro-1-(2,6-dichlorophenyl)ethanone 95%, 2-Chloro-1-(2,6-dichlorophenyl)ethanone, 95%, 95%. Offered by: Chemat Brand, Ambeed, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
2-chloro-1-(2,6-dichlorophenyl)ethanone (CAS 81547-71-9) is a chemical compound with the molecular formula C8H5Cl3O and a molecular weight of 223.5 g/mol. IUPAC name: 2-chloro-1-(2,6-dichlorophenyl)ethanone. InChIKey: BDSOXPYZEQTVTC-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O |
|---|---|
| Molecular weight | 223.5 g/mol |
| IUPAC name | 2-chloro-1-(2,6-dichlorophenyl)ethanone |
| InChIKey | BDSOXPYZEQTVTC-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)C(=O)CCl)Cl |
Computed by PubChem (NCBI)