CAS 13608-87-2 appears in our catalog under these names: 2',3',4'-Trichloroacetophenone, 2',3',4'-Trichloroacetophenone, 95%, 2',3',4'-Trichloroacetophenone, >98.0%(GC), 2',3',4'-Trichloroacetophenone, >98.0%(GC), >98.0%(GC), 2',3',4'-Trichloroacetophenone, 98%(GC-MS),RG. Offered by: Biosynth, Combi-blocks, TCI, Chemat, Fluorochem. Available pack sizes: 2,5g, 0,25g, 1g, 5g, 100g, 25g.
1-(2,3,4-trichlorophenyl)ethanone (CAS 13608-87-2) is a chemical compound with the molecular formula C8H5Cl3O and a molecular weight of 223.5 g/mol. IUPAC name: 1-(2,3,4-trichlorophenyl)ethanone. InChIKey: BXJZZJYNVIDEKG-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O |
|---|---|
| Molecular weight | 223.5 g/mol |
| IUPAC name | 1-(2,3,4-trichlorophenyl)ethanone |
| InChIKey | BXJZZJYNVIDEKG-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=C(C=C1)Cl)Cl)Cl |
Computed by PubChem (NCBI)