CAS 7396-79-4 appears in our catalog under these names: 2',2,5 Trichloroacetophenone, 2,2',5'-Trichloroacetophenone, >95% (HPLC), 2-Chloro-1-(2,5-dichlorophenyl)ethan-1-one. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 250mg, 25mg, 50mg, 5g, 0,5g.
2-chloro-1-(2,5-dichlorophenyl)ethanone (CAS 7396-79-4) is a chemical compound with the molecular formula C8H5Cl3O and a molecular weight of 223.5 g/mol. IUPAC name: 2-chloro-1-(2,5-dichlorophenyl)ethanone. InChIKey: CXEVBWANBXAQSY-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl3O |
|---|---|
| Molecular weight | 223.5 g/mol |
| IUPAC name | 2-chloro-1-(2,5-dichlorophenyl)ethanone |
| InChIKey | CXEVBWANBXAQSY-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)C(=O)CCl)Cl |
Computed by PubChem (NCBI)