Products 1391399-74-8
CAS 1391399-74-8 appears in our catalog under these names: (S)-Methyl 3-amino-3-(2-chlorophenyl)propanoate hydrochloride, 98%, 98%, METHYL (3S)-3-AMINO-3-(2-CHLOROPHENYL)PROPANOATE HYDROCHLORIDE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
Methyl (3S)-3-amino-3-(2-chlorophenyl)propanoate;hydrochloride (CAS 1391399-74-8) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: methyl (3S)-3-amino-3-(2-chlorophenyl)propanoate;hydrochloride. InChIKey: LPBJVSCNUUOIGM-FVGYRXGTSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | methyl (3S)-3-amino-3-(2-chlorophenyl)propanoate;hydrochloride |
| InChIKey | LPBJVSCNUUOIGM-FVGYRXGTSA-N |
| SMILES | COC(=O)C[C@@H](C1=CC=CC=C1Cl)N.Cl |
Computed by PubChem (NCBI)