Products 1172342-74-3

CAS 1172342-74-3 is the registry number for 3-{((3-Chlorophenyl)methyl)amino}propanoic acid hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

3-[(3-chlorophenyl)methylamino]propanoic acid;hydrochloride (CAS 1172342-74-3) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: 3-[(3-chlorophenyl)methylamino]propanoic acid;hydrochloride. InChIKey: TZBRYZAAFUVUCO-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13Cl2NO2
Molecular weight250.12 g/mol
IUPAC name3-[(3-chlorophenyl)methylamino]propanoic acid;hydrochloride
InChIKeyTZBRYZAAFUVUCO-UHFFFAOYSA-N
SMILESC1=CC(=CC(=C1)Cl)CNCCC(=O)O.Cl

Computed by PubChem (NCBI)