CAS 1172479-10-5 appears in our catalog under these names: 3-{((4-chlorophenyl)methyl)amino}propanoic acid hydrochloride, 97%, 3-{((4-Chlorophenyl)methyl)amino}propanoic acid hydrochloride, 3-{[(4-chlorophenyl)methyl]amino}propanoic acid hydrochloride, 97%, 97%, 3-{[(4-chlorophenyl)methyl]amino}propanoic acid hydrochloride, 97%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 1g, 100mg, 250mg, 5g, 500mg.
3-[(4-chlorophenyl)methylamino]propanoic acid;hydrochloride (CAS 1172479-10-5) is a chemical compound with the molecular formula C10H13Cl2NO2 and a molecular weight of 250.12 g/mol. IUPAC name: 3-[(4-chlorophenyl)methylamino]propanoic acid;hydrochloride. InChIKey: HLAILPIZHMVJGM-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2NO2 |
|---|---|
| Molecular weight | 250.12 g/mol |
| IUPAC name | 3-[(4-chlorophenyl)methylamino]propanoic acid;hydrochloride |
| InChIKey | HLAILPIZHMVJGM-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CNCCC(=O)O)Cl.Cl |
Computed by PubChem (NCBI)