Products 1176011-54-3
CAS 1176011-54-3 is the registry number for 6-Phenyl-5H-[1,3]dioxolo[4',5':4,5]benzo[1,2-d]imidazole, 95%. Offered by: Ambeed, Chemat, BLDpharm. Available pack sizes: 250mg, 1g, 100mg.
6-phenyl-5H-[1,3]dioxolo[4,5-f]benzimidazole (CAS 1176011-54-3) is a chemical compound with the molecular formula C14H10N2O2 and a molecular weight of 238.24 g/mol. IUPAC name: 6-phenyl-5H-[1,3]dioxolo[4,5-f]benzimidazole. InChIKey: WZSYHIZKLPENQK-UHFFFAOYSA-N.
| Molecular formula | C14H10N2O2 |
|---|---|
| Molecular weight | 238.24 g/mol |
| IUPAC name | 6-phenyl-5H-[1,3]dioxolo[4,5-f]benzimidazole |
| InChIKey | WZSYHIZKLPENQK-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C=C3C(=C2)NC(=N3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)