CAS 117738-76-8 appears in our catalog under these names: 4-Chloro-3-cyanobenzoic acid, 95%, 4–Chloro–3–cyanobenzoic acid, 4-Chloro-3-cyanobenzoic acid, 4-Chloro-3-cyanobenzoic acid 97%, 4-Chloro-3-cyanobenzoic acid, 98%, 98%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 100mg, 5g, 250mg, 2,5g, 500mg.
4-chloro-3-cyanobenzoic acid (CAS 117738-76-8) is a chemical compound with the molecular formula C8H4ClNO2 and a molecular weight of 181.57 g/mol. IUPAC name: 4-chloro-3-cyanobenzoic acid. InChIKey: FYNLALHBLSJPBQ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2 |
|---|---|
| Molecular weight | 181.57 g/mol |
| IUPAC name | 4-chloro-3-cyanobenzoic acid |
| InChIKey | FYNLALHBLSJPBQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)O)C#N)Cl |
Computed by PubChem (NCBI)