Products 51108-30-6
CAS 51108-30-6 appears in our catalog under these names: 1H-Isoindole-1,3(2h)-dione, 4-chloro-, 95%, 4–Chloroisoindoline–1，3–dione, 4-Chloroisoindoline-1,3-dione 98%, 4-Chloroisoindoline-1，3-dione, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg.
4-chloroisoindole-1,3-dione (CAS 51108-30-6) is a chemical compound with the molecular formula C8H4ClNO2 and a molecular weight of 181.57 g/mol. IUPAC name: 4-chloroisoindole-1,3-dione. InChIKey: APOAEMIYHVGWEZ-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2 |
|---|---|
| Molecular weight | 181.57 g/mol |
| IUPAC name | 4-chloroisoindole-1,3-dione |
| InChIKey | APOAEMIYHVGWEZ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)C(=O)NC2=O |
Computed by PubChem (NCBI)
Synonyms:
4-Chloroisoindoline-1,3-dione, 4-chloroisoindole-1,3-dione, 1H-Isoindole-1,3(2H)-dione, 4-chloro-, 4-chloro-1h-isoindole-1,3(2h)-dione, 4-chloro-2,3-dihydro-1H-isoindole-1,3-dione, 3-chlorophthalimide, Chlorphthalimid, 4-Chloroisoindoline-13-dione, 4-chloro-isoindole-1,3-dione, APOAEMIYHVGWEZ-UHFFFAOYSA-N