CAS 1891205-92-7 is the registry number for 6-Chlorobenzo[d][1,3]dioxole-4-carbonitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6-chloro-1,3-benzodioxole-4-carbonitrile (CAS 1891205-92-7) is a chemical compound with the molecular formula C8H4ClNO2 and a molecular weight of 181.57 g/mol. IUPAC name: 6-chloro-1,3-benzodioxole-4-carbonitrile. InChIKey: UPDXFTNEVVFBCP-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2 |
|---|---|
| Molecular weight | 181.57 g/mol |
| IUPAC name | 6-chloro-1,3-benzodioxole-4-carbonitrile |
| InChIKey | UPDXFTNEVVFBCP-UHFFFAOYSA-N |
| SMILES | C1OC2=CC(=CC(=C2O1)C#N)Cl |
Computed by PubChem (NCBI)