CAS 1780906-87-7 is the registry number for 7-Chlorobenzo[c]isoxazole-3-carbaldehyde, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
7-chloro-2,1-benzoxazole-3-carbaldehyde (CAS 1780906-87-7) is a chemical compound with the molecular formula C8H4ClNO2 and a molecular weight of 181.57 g/mol. IUPAC name: 7-chloro-2,1-benzoxazole-3-carbaldehyde. InChIKey: KQRWMUKNMBZZGI-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2 |
|---|---|
| Molecular weight | 181.57 g/mol |
| IUPAC name | 7-chloro-2,1-benzoxazole-3-carbaldehyde |
| InChIKey | KQRWMUKNMBZZGI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(ON=C2C(=C1)Cl)C=O |
Computed by PubChem (NCBI)