CAS 5180-79-0 is the registry number for 3-Isocyanatobenzoylchloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
3-isocyanatobenzoyl chloride (CAS 5180-79-0) is a chemical compound with the molecular formula C8H4ClNO2 and a molecular weight of 181.57 g/mol. IUPAC name: 3-isocyanatobenzoyl chloride. InChIKey: WBLVOWAHPPPNLF-UHFFFAOYSA-N.
| Molecular formula | C8H4ClNO2 |
|---|---|
| Molecular weight | 181.57 g/mol |
| IUPAC name | 3-isocyanatobenzoyl chloride |
| InChIKey | WBLVOWAHPPPNLF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)N=C=O)C(=O)Cl |
Computed by PubChem (NCBI)